C13H14N2O6 — CID 134875094
ethyl 2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetate (PubChem CID 134875094) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is ethyl 2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetate.
| Compound Name | ethyl 2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetate |
|---|---|
| PubChem CID | 134875094 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | ethyl 2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methylideneamino]acetate |
| SMILES | CCOC(=O)C/N=C/c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C13H14N2O6/c1-2-19-13(16)8-14-7-9-5-11-12(21-4-3-20-11)6-10(9)15(17)18/h5-7H,2-4,8H2,1H3/b14-7+ |
| InChIKey | UDMZVDVCEMVHGV-VGOFMYFVSA-N |
| XLogP | 1.35 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|