C11H12N2O7 — CID 2925645
1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate (PubChem CID 2925645) has the molecular formula C11H12N2O7 and a molecular weight of 284.22 g/mol. Its IUPAC name is 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate.
| Compound Name | 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate |
|---|---|
| PubChem CID | 2925645 |
| Molecular Formula | C11H12N2O7 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate |
| SMILES | CCC(O[N+](=O)[O-])c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C11H12N2O7/c1-2-9(20-13(16)17)7-5-10-11(19-4-3-18-10)6-8(7)12(14)15/h5-6,9H,2-4H2,1H3 |
| InChIKey | WFAWVMCQKPCFFF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|