1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate

C11H12N2O7 — CID 2925645

IUPAC1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate
SMILESCCC(O[N+](=O)[O-])c1cc2c(cc1[N+](=O)[O-])OCCO2
InChIInChI=1S/C11H12N2O7/c1-2-9(20-13(16)17)7-5-10-11(19-4-3-18-10)6-8(7)12(14)15/h5-6,9H,2-4H2,1H3
InChIKeyWFAWVMCQKPCFFF-UHFFFAOYSA-N
MW284.22 g/mol
LogP2.03
Rot. Bonds5

About 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate

1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate (PubChem CID 2925645) has the molecular formula C11H12N2O7 and a molecular weight of 284.22 g/mol. Its IUPAC name is 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate.

Molecular Properties

Compound Name1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate
PubChem CID2925645
Molecular FormulaC11H12N2O7
Molecular Weight284.22 g/mol
Exact Mass284.06
IUPAC Name1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate
SMILESCCC(O[N+](=O)[O-])c1cc2c(cc1[N+](=O)[O-])OCCO2
InChIInChI=1S/C11H12N2O7/c1-2-9(20-13(16)17)7-5-10-11(19-4-3-18-10)6-8(7)12(14)15/h5-6,9H,2-4H2,1H3
InChIKeyWFAWVMCQKPCFFF-UHFFFAOYSA-N
XLogP2.03
TPSA113.97 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.22
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate?
The IUPAC name of 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate (CID 2925645) is 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate.
What is the SMILES notation for 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate?
The canonical SMILES for 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate is CCC(O[N+](=O)[O-])c1cc2c(cc1[N+](=O)[O-])OCCO2.
What is the InChIKey of 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate?
The InChIKey is WFAWVMCQKPCFFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O7/c1-2-9(20-13(16)17)7-5-10-11(19-4-3-18-10)6-8(7)12(14)15/h5-6,9H,2-4H2,1H3.
What are the key properties of 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate?
1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate has a molecular weight of 284.22 g/mol, XLogP of 2.03, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)propyl nitrate is sourced from PubChem (CID 2925645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).