C24H28N2O12S2 — CID 10507791
14-nitro-15-[(15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl)disulfanyl]-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene (PubChem CID 10507791) has the molecular formula C24H28N2O12S2 and a molecular weight of 600.62 g/mol. Its IUPAC name is 14-nitro-15-[(15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl)disulfanyl]-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene.
| Compound Name | 14-nitro-15-[(15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl)disulfanyl]-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene |
|---|---|
| PubChem CID | 10507791 |
| Molecular Formula | C24H28N2O12S2 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | 14-nitro-15-[(15-nitro-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl)disulfanyl]-2,5,8,11-tetraoxabicyclo[10.4.0]hexadeca-1(12),13,15-triene |
| SMILES | O=[N+]([O-])c1cc2c(cc1SSc1cc3c(cc1[N+](=O)[O-])OCCOCCOCCO3)OCCOCCOCCO2 |
| InChI | InChI=1S/C24H28N2O12S2/c27-25(28)17-13-19-21(37-11-7-33-3-1-31-5-9-35-19)15-23(17)39-40-24-16-22-20(14-18(24)26(29)30)36-10-6-32-2-4-34-8-12-38-22/h13-16H,1-12H2 |
| InChIKey | VZWMXOOROOWUPR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 160.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|