C8H4N2O4S — CID 1210953
(6-nitro-1,3-benzodioxol-5-yl) thiocyanate (PubChem CID 1210953) has the molecular formula C8H4N2O4S and a molecular weight of 224.20 g/mol. Its IUPAC name is (6-nitro-1,3-benzodioxol-5-yl) thiocyanate.
| Compound Name | (6-nitro-1,3-benzodioxol-5-yl) thiocyanate |
|---|---|
| PubChem CID | 1210953 |
| Molecular Formula | C8H4N2O4S |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | (6-nitro-1,3-benzodioxol-5-yl) thiocyanate |
| SMILES | N#CSc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C8H4N2O4S/c9-3-15-8-2-7-6(13-4-14-7)1-5(8)10(11)12/h1-2H,4H2 |
| InChIKey | FJINCQJCFYLVEJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|