C9H12ClN3O4 — CID 171228045
(1R)-1-(6-nitro-1,3-benzodioxol-5-yl)ethane-1,2-diamine;hydrochloride (PubChem CID 171228045) has the molecular formula C9H12ClN3O4 and a molecular weight of 261.67 g/mol. Its IUPAC name is (1R)-1-(6-nitro-1,3-benzodioxol-5-yl)ethane-1,2-diamine;hydrochloride.
| Compound Name | (1R)-1-(6-nitro-1,3-benzodioxol-5-yl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 171228045 |
| Molecular Formula | C9H12ClN3O4 |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | (1R)-1-(6-nitro-1,3-benzodioxol-5-yl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NC[C@H](N)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C9H11N3O4.ClH/c10-3-6(11)5-1-8-9(16-4-15-8)2-7(5)12(13)14;/h1-2,6H,3-4,10-11H2;1H/t6-;/m0./s1 |
| InChIKey | AZNRQTIBESXWIJ-RGMNGODLSA-N |
| XLogP | 0.70 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|