C14H18N2O4 — CID 171228079
(S)-cyclohexyl-(6-nitro-1,3-benzodioxol-5-yl)methanamine (PubChem CID 171228079) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (S)-cyclohexyl-(6-nitro-1,3-benzodioxol-5-yl)methanamine.
| Compound Name | (S)-cyclohexyl-(6-nitro-1,3-benzodioxol-5-yl)methanamine |
|---|---|
| PubChem CID | 171228079 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (S)-cyclohexyl-(6-nitro-1,3-benzodioxol-5-yl)methanamine |
| SMILES | N[C@H](c1cc2c(cc1[N+](=O)[O-])OCO2)C1CCCCC1 |
| InChI | InChI=1S/C14H18N2O4/c15-14(9-4-2-1-3-5-9)10-6-12-13(20-8-19-12)7-11(10)16(17)18/h6-7,9,14H,1-5,8,15H2/t14-/m0/s1 |
| InChIKey | CTTWRCTUXRRBEB-AWEZNQCLSA-N |
| XLogP | 2.90 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|