C15H23ClN2O4 — CID 171213468
(R)-cyclohexyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride (PubChem CID 171213468) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is (R)-cyclohexyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride.
| Compound Name | (R)-cyclohexyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171213468 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (R)-cyclohexyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride |
| SMILES | COc1cc([C@H](N)C2CCCCC2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C15H22N2O4.ClH/c1-20-13-8-11(12(17(18)19)9-14(13)21-2)15(16)10-6-4-3-5-7-10;/h8-10,15H,3-7,16H2,1-2H3;1H/t15-;/m1./s1 |
| InChIKey | SILCHXLQAHPAFC-XFULWGLBSA-N |
| XLogP | 3.61 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|