C13H19ClN2O4 — CID 171233083
(S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride (PubChem CID 171233083) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is (S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride.
| Compound Name | (S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171233083 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (S)-cyclobutyl-(4,5-dimethoxy-2-nitrophenyl)methanamine;hydrochloride |
| SMILES | COc1cc([C@@H](N)C2CCC2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C13H18N2O4.ClH/c1-18-11-6-9(13(14)8-4-3-5-8)10(15(16)17)7-12(11)19-2;/h6-8,13H,3-5,14H2,1-2H3;1H/t13-;/m0./s1 |
| InChIKey | CIRNCLNVMTWXDA-ZOWNYOTGSA-N |
| XLogP | 2.83 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|