C13H20N2O4 — CID 171213477
(1R)-1-(4,5-dimethoxy-2-nitrophenyl)-2-methylbutan-1-amine (PubChem CID 171213477) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethoxy-2-nitrophenyl)-2-methylbutan-1-amine.
| Compound Name | (1R)-1-(4,5-dimethoxy-2-nitrophenyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 171213477 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (1R)-1-(4,5-dimethoxy-2-nitrophenyl)-2-methylbutan-1-amine |
| SMILES | CCC(C)[C@@H](N)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N2O4/c1-5-8(2)13(14)9-6-11(18-3)12(19-4)7-10(9)15(16)17/h6-8,13H,5,14H2,1-4H3/t8?,13-/m1/s1 |
| InChIKey | OAFWNFWCRLLANS-AZMWARKLSA-N |
| XLogP | 2.66 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|