C10H13NO5 — CID 916122
(1R)-1-(4,5-dimethoxy-2-nitrophenyl)ethanol (PubChem CID 916122) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethoxy-2-nitrophenyl)ethanol.
| Compound Name | (1R)-1-(4,5-dimethoxy-2-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 916122 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (1R)-1-(4,5-dimethoxy-2-nitrophenyl)ethanol |
| SMILES | COc1cc([C@@H](C)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H13NO5/c1-6(12)7-4-9(15-2)10(16-3)5-8(7)11(13)14/h4-6,12H,1-3H3/t6-/m1/s1 |
| InChIKey | KMRZADDYRLREOY-ZCFIWIBFSA-N |
| XLogP | 1.67 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|