C11H16N2O3 — CID 171226044
3-[(1S)-1-amino-2-methylbutyl]-4-nitrophenol (PubChem CID 171226044) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-[(1S)-1-amino-2-methylbutyl]-4-nitrophenol.
| Compound Name | 3-[(1S)-1-amino-2-methylbutyl]-4-nitrophenol |
|---|---|
| PubChem CID | 171226044 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-[(1S)-1-amino-2-methylbutyl]-4-nitrophenol |
| SMILES | CCC(C)[C@H](N)c1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O3/c1-3-7(2)11(12)9-6-8(14)4-5-10(9)13(15)16/h4-7,11,14H,3,12H2,1-2H3/t7?,11-/m0/s1 |
| InChIKey | WTIUFGRHUHBWQA-QRIDDKLISA-N |
| XLogP | 2.35 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|