C8H11N3O3 — CID 55264320
3-[(1S)-1,2-diaminoethyl]-4-nitrophenol (PubChem CID 55264320) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-[(1S)-1,2-diaminoethyl]-4-nitrophenol.
| Compound Name | 3-[(1S)-1,2-diaminoethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 55264320 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3-[(1S)-1,2-diaminoethyl]-4-nitrophenol |
| SMILES | NC[C@@H](N)c1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N3O3/c9-4-7(10)6-3-5(12)1-2-8(6)11(13)14/h1-3,7,12H,4,9-10H2/t7-/m1/s1 |
| InChIKey | RHUWSTUOXNGWAF-SSDOTTSWSA-N |
| XLogP | 0.26 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|