C8H13N3O — CID 55283127
4-amino-3-(1,2-diaminoethyl)phenol (PubChem CID 55283127) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-amino-3-(1,2-diaminoethyl)phenol.
| Compound Name | 4-amino-3-(1,2-diaminoethyl)phenol |
|---|---|
| PubChem CID | 55283127 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4-amino-3-(1,2-diaminoethyl)phenol |
| SMILES | NCC(N)c1cc(O)ccc1N |
| InChI | InChI=1S/C8H13N3O/c9-4-8(11)6-3-5(12)1-2-7(6)10/h1-3,8,12H,4,9-11H2 |
| InChIKey | HMZLIKGFNYAVPA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|