C8H12FN3O — CID 55273541
4-amino-2-[(1S)-1,2-diaminoethyl]-5-fluorophenol (PubChem CID 55273541) has the molecular formula C8H12FN3O and a molecular weight of 185.20 g/mol. Its IUPAC name is 4-amino-2-[(1S)-1,2-diaminoethyl]-5-fluorophenol.
| Compound Name | 4-amino-2-[(1S)-1,2-diaminoethyl]-5-fluorophenol |
|---|---|
| PubChem CID | 55273541 |
| Molecular Formula | C8H12FN3O |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-amino-2-[(1S)-1,2-diaminoethyl]-5-fluorophenol |
| SMILES | NC[C@@H](N)c1cc(N)c(F)cc1O |
| InChI | InChI=1S/C8H12FN3O/c9-5-2-8(13)4(1-6(5)11)7(12)3-10/h1-2,7,13H,3,10-12H2/t7-/m1/s1 |
| InChIKey | HPJGWNQVYNKHCF-SSDOTTSWSA-N |
| XLogP | 0.07 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|