C9H14FN3 — CID 130739605
(1S)-1-(2-amino-4-fluoro-5-methylphenyl)ethane-1,2-diamine (PubChem CID 130739605) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is (1S)-1-(2-amino-4-fluoro-5-methylphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2-amino-4-fluoro-5-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130739605 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | (1S)-1-(2-amino-4-fluoro-5-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc([C@H](N)CN)c(N)cc1F |
| InChI | InChI=1S/C9H14FN3/c1-5-2-6(9(13)4-11)8(12)3-7(5)10/h2-3,9H,4,11-13H2,1H3/t9-/m1/s1 |
| InChIKey | NMNWEJDRFBERDO-SECBINFHSA-N |
| XLogP | 0.67 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|