C8H11F2N3 — CID 77130849
1-(4-amino-2,6-difluorophenyl)ethane-1,2-diamine (PubChem CID 77130849) has the molecular formula C8H11F2N3 and a molecular weight of 187.19 g/mol. Its IUPAC name is 1-(4-amino-2,6-difluorophenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-amino-2,6-difluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 77130849 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 1-(4-amino-2,6-difluorophenyl)ethane-1,2-diamine |
| SMILES | NCC(N)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C8H11F2N3/c9-5-1-4(12)2-6(10)8(5)7(13)3-11/h1-2,7H,3,11-13H2 |
| InChIKey | PFRPQSRZMDMRLI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|