C8H11ClF2N2 — CID 171223663
(1R)-1-(2,6-difluorophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 171223663) has the molecular formula C8H11ClF2N2 and a molecular weight of 208.64 g/mol. Its IUPAC name is (1R)-1-(2,6-difluorophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | (1R)-1-(2,6-difluorophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 171223663 |
| Molecular Formula | C8H11ClF2N2 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (1R)-1-(2,6-difluorophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NC[C@H](N)c1c(F)cccc1F |
| InChI | InChI=1S/C8H10F2N2.ClH/c9-5-2-1-3-6(10)8(5)7(12)4-11;/h1-3,7H,4,11-12H2;1H/t7-;/m0./s1 |
| InChIKey | FCFMXXFRUDNICM-FJXQXJEOSA-N |
| XLogP | 1.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |