C10H14ClF2N — CID 86262880
1-(2,6-difluorophenyl)butan-1-amine;hydrochloride (PubChem CID 86262880) has the molecular formula C10H14ClF2N and a molecular weight of 221.68 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)butan-1-amine;hydrochloride.
| Compound Name | 1-(2,6-difluorophenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 86262880 |
| Molecular Formula | C10H14ClF2N |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1-(2,6-difluorophenyl)butan-1-amine;hydrochloride |
| SMILES | CCCC(N)c1c(F)cccc1F.Cl |
| InChI | InChI=1S/C10H13F2N.ClH/c1-2-4-9(13)10-7(11)5-3-6-8(10)12;/h3,5-6,9H,2,4,13H2,1H3;1H |
| InChIKey | DTRLUCVZPTURJD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |