C12H17F2NO2S — CID 79522023
1-(2,6-difluorophenyl)-4-ethylsulfonylbutan-1-amine (PubChem CID 79522023) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-4-ethylsulfonylbutan-1-amine.
| Compound Name | 1-(2,6-difluorophenyl)-4-ethylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 79522023 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(2,6-difluorophenyl)-4-ethylsulfonylbutan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(N)c1c(F)cccc1F |
| InChI | InChI=1S/C12H17F2NO2S/c1-2-18(16,17)8-4-7-11(15)12-9(13)5-3-6-10(12)14/h3,5-6,11H,2,4,7-8,15H2,1H3 |
| InChIKey | TWNOEKZJYREAKW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |