C12H18ClNO2S — CID 65095643
1-(3-chlorophenyl)-4-ethylsulfonylbutan-1-amine (PubChem CID 65095643) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-ethylsulfonylbutan-1-amine.
| Compound Name | 1-(3-chlorophenyl)-4-ethylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 65095643 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(3-chlorophenyl)-4-ethylsulfonylbutan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H18ClNO2S/c1-2-17(15,16)8-4-7-12(14)10-5-3-6-11(13)9-10/h3,5-6,9,12H,2,4,7-8,14H2,1H3 |
| InChIKey | KFUXIXBTUHTSMG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |