C10H11ClF3N — CID 171219105
(1S)-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 171219105) has the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. Its IUPAC name is (1S)-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | (1S)-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 171219105 |
| Molecular Formula | C10H11ClF3N |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | (1S)-1-(3-chlorophenyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | N[C@@H](CCC(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H11ClF3N/c11-8-3-1-2-7(6-8)9(15)4-5-10(12,13)14/h1-3,6,9H,4-5,15H2/t9-/m0/s1 |
| InChIKey | CULQTCGEZVHEAL-VIFPVBQESA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |