C9H14Cl2N2 — CID 171199565
(1R)-1-(3-chlorophenyl)propane-1,3-diamine;hydrochloride (PubChem CID 171199565) has the molecular formula C9H14Cl2N2 and a molecular weight of 221.13 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1R)-1-(3-chlorophenyl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171199565 |
| Molecular Formula | C9H14Cl2N2 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCC[C@@H](N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H13ClN2.ClH/c10-8-3-1-2-7(6-8)9(12)4-5-11;/h1-3,6,9H,4-5,11-12H2;1H/t9-;/m1./s1 |
| InChIKey | NEZOTYOHDKEXDZ-SBSPUUFOSA-N |
| XLogP | 2.11 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |