C10H15ClN2 — CID 79093670
1-(3-chlorophenyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 79093670) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | 1-(3-chlorophenyl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 79093670 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-(3-chlorophenyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CC(N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H15ClN2/c1-13(2)7-10(12)8-4-3-5-9(11)6-8/h3-6,10H,7,12H2,1-2H3 |
| InChIKey | JQIGTMFKFVAIFZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |