C13H21ClN2 — CID 170878710
4-(3-chlorophenyl)heptane-1,7-diamine (PubChem CID 170878710) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 4-(3-chlorophenyl)heptane-1,7-diamine.
| Compound Name | 4-(3-chlorophenyl)heptane-1,7-diamine |
|---|---|
| PubChem CID | 170878710 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-(3-chlorophenyl)heptane-1,7-diamine |
| SMILES | NCCCC(CCCN)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H21ClN2/c14-13-7-1-4-12(10-13)11(5-2-8-15)6-3-9-16/h1,4,7,10-11H,2-3,5-6,8-9,15-16H2 |
| InChIKey | WMBYLKKHHODIPH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |