C11H16ClNO — CID 79443641
2-(3-chlorophenyl)-4-methoxybutan-1-amine (PubChem CID 79443641) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-methoxybutan-1-amine.
| Compound Name | 2-(3-chlorophenyl)-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 79443641 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(3-chlorophenyl)-4-methoxybutan-1-amine |
| SMILES | COCCC(CN)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H16ClNO/c1-14-6-5-10(8-13)9-3-2-4-11(12)7-9/h2-4,7,10H,5-6,8,13H2,1H3 |
| InChIKey | URLDIDSHWBQDOB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |