C14H22ClNO2 — CID 103183699
2-(3-chlorophenyl)-4-(3-methoxypropoxy)butan-1-amine (PubChem CID 103183699) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-(3-methoxypropoxy)butan-1-amine.
| Compound Name | 2-(3-chlorophenyl)-4-(3-methoxypropoxy)butan-1-amine |
|---|---|
| PubChem CID | 103183699 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-(3-chlorophenyl)-4-(3-methoxypropoxy)butan-1-amine |
| SMILES | COCCCOCCC(CN)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H22ClNO2/c1-17-7-3-8-18-9-6-13(11-16)12-4-2-5-14(15)10-12/h2,4-5,10,13H,3,6-9,11,16H2,1H3 |
| InChIKey | QHQULJZWZUSSHH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|