C17H28ClNO — CID 79443466
4-butoxy-2-(3-chlorophenyl)-N-propylbutan-1-amine (PubChem CID 79443466) has the molecular formula C17H28ClNO and a molecular weight of 297.87 g/mol. Its IUPAC name is 4-butoxy-2-(3-chlorophenyl)-N-propylbutan-1-amine.
| Compound Name | 4-butoxy-2-(3-chlorophenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79443466 |
| Molecular Formula | C17H28ClNO |
| Molecular Weight | 297.87 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-butoxy-2-(3-chlorophenyl)-N-propylbutan-1-amine |
| SMILES | CCCCOCCC(CNCCC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H28ClNO/c1-3-5-11-20-12-9-16(14-19-10-4-2)15-7-6-8-17(18)13-15/h6-8,13,16,19H,3-5,9-12,14H2,1-2H3 |
| InChIKey | IVYGHDXYJRTUDG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|