C19H32ClN — CID 79433186
2-(3-chlorophenyl)-N-(2-methylpropyl)nonan-1-amine (PubChem CID 79433186) has the molecular formula C19H32ClN and a molecular weight of 309.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(2-methylpropyl)nonan-1-amine.
| Compound Name | 2-(3-chlorophenyl)-N-(2-methylpropyl)nonan-1-amine |
|---|---|
| PubChem CID | 79433186 |
| Molecular Formula | C19H32ClN |
| Molecular Weight | 309.93 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(2-methylpropyl)nonan-1-amine |
| SMILES | CCCCCCCC(CNCC(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H32ClN/c1-4-5-6-7-8-10-18(15-21-14-16(2)3)17-11-9-12-19(20)13-17/h9,11-13,16,18,21H,4-8,10,14-15H2,1-3H3 |
| InChIKey | AUPULGKXHIVEFL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.93 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|