C18H30ClN — CID 83169178
N-tert-butyl-2-(3-chlorophenyl)-6-methylheptan-1-amine (PubChem CID 83169178) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is N-tert-butyl-2-(3-chlorophenyl)-6-methylheptan-1-amine.
| Compound Name | N-tert-butyl-2-(3-chlorophenyl)-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 83169178 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N-tert-butyl-2-(3-chlorophenyl)-6-methylheptan-1-amine |
| SMILES | CC(C)CCCC(CNC(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H30ClN/c1-14(2)8-6-10-16(13-20-18(3,4)5)15-9-7-11-17(19)12-15/h7,9,11-12,14,16,20H,6,8,10,13H2,1-5H3 |
| InChIKey | GQDZCSVCZFEJQT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |