C18H30FN — CID 83168684
N-tert-butyl-2-(4-fluorophenyl)-6-methylheptan-1-amine (PubChem CID 83168684) has the molecular formula C18H30FN and a molecular weight of 279.44 g/mol. Its IUPAC name is N-tert-butyl-2-(4-fluorophenyl)-6-methylheptan-1-amine.
| Compound Name | N-tert-butyl-2-(4-fluorophenyl)-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 83168684 |
| Molecular Formula | C18H30FN |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-tert-butyl-2-(4-fluorophenyl)-6-methylheptan-1-amine |
| SMILES | CC(C)CCCC(CNC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H30FN/c1-14(2)7-6-8-16(13-20-18(3,4)5)15-9-11-17(19)12-10-15/h9-12,14,16,20H,6-8,13H2,1-5H3 |
| InChIKey | YJPLBLFWGUJQLL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |