C16H27ClN2 — CID 62985951
N'-[1-(3-chlorophenyl)ethyl]-N'-methylheptane-1,7-diamine (PubChem CID 62985951) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)ethyl]-N'-methylheptane-1,7-diamine.
| Compound Name | N'-[1-(3-chlorophenyl)ethyl]-N'-methylheptane-1,7-diamine |
|---|---|
| PubChem CID | 62985951 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N'-[1-(3-chlorophenyl)ethyl]-N'-methylheptane-1,7-diamine |
| SMILES | CC(c1cccc(Cl)c1)N(C)CCCCCCCN |
| InChI | InChI=1S/C16H27ClN2/c1-14(15-9-8-10-16(17)13-15)19(2)12-7-5-3-4-6-11-18/h8-10,13-14H,3-7,11-12,18H2,1-2H3 |
| InChIKey | FYBDMUXPAHUEPA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|