C12H19ClN2 — CID 62980472
N'-[1-(4-chlorophenyl)ethyl]-N'-methylpropane-1,3-diamine (PubChem CID 62980472) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)ethyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-[1-(4-chlorophenyl)ethyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62980472 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-[1-(4-chlorophenyl)ethyl]-N'-methylpropane-1,3-diamine |
| SMILES | CC(c1ccc(Cl)cc1)N(C)CCCN |
| InChI | InChI=1S/C12H19ClN2/c1-10(15(2)9-3-8-14)11-4-6-12(13)7-5-11/h4-7,10H,3,8-9,14H2,1-2H3 |
| InChIKey | DIYFXUXCNYNIRV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |