C13H22N2 — CID 112509797
N'-methyl-N'-(1-phenylethyl)butane-1,4-diamine (PubChem CID 112509797) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-methyl-N'-(1-phenylethyl)butane-1,4-diamine.
| Compound Name | N'-methyl-N'-(1-phenylethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 112509797 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-methyl-N'-(1-phenylethyl)butane-1,4-diamine |
| SMILES | CC(c1ccccc1)N(C)CCCCN |
| InChI | InChI=1S/C13H22N2/c1-12(13-8-4-3-5-9-13)15(2)11-7-6-10-14/h3-5,8-9,12H,6-7,10-11,14H2,1-2H3 |
| InChIKey | XFWUPIBDJSXDJL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|