C15H26N2O2S — CID 107206887
N-(5-aminopentyl)-N-methyl-2-phenylpropane-1-sulfonamide (PubChem CID 107206887) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N-(5-aminopentyl)-N-methyl-2-phenylpropane-1-sulfonamide.
| Compound Name | N-(5-aminopentyl)-N-methyl-2-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 107206887 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-(5-aminopentyl)-N-methyl-2-phenylpropane-1-sulfonamide |
| SMILES | CC(CS(=O)(=O)N(C)CCCCCN)c1ccccc1 |
| InChI | InChI=1S/C15H26N2O2S/c1-14(15-9-5-3-6-10-15)13-20(18,19)17(2)12-8-4-7-11-16/h3,5-6,9-10,14H,4,7-8,11-13,16H2,1-2H3 |
| InChIKey | RJTCVLPDXLPKJZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|