C12H19N3O2 — CID 81493189
N'-methyl-N'-[1-(3-nitrophenyl)ethyl]propane-1,3-diamine (PubChem CID 81493189) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N'-methyl-N'-[1-(3-nitrophenyl)ethyl]propane-1,3-diamine.
| Compound Name | N'-methyl-N'-[1-(3-nitrophenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 81493189 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N'-methyl-N'-[1-(3-nitrophenyl)ethyl]propane-1,3-diamine |
| SMILES | CC(c1cccc([N+](=O)[O-])c1)N(C)CCCN |
| InChI | InChI=1S/C12H19N3O2/c1-10(14(2)8-4-7-13)11-5-3-6-12(9-11)15(16)17/h3,5-6,9-10H,4,7-8,13H2,1-2H3 |
| InChIKey | ZLQTYHNDJDHTGO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|