C12H15N5O2 — CID 95785853
(1S)-N-methyl-1-(3-nitrophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine (PubChem CID 95785853) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is (1S)-N-methyl-1-(3-nitrophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine.
| Compound Name | (1S)-N-methyl-1-(3-nitrophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 95785853 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (1S)-N-methyl-1-(3-nitrophenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)ethanamine |
| SMILES | C[C@@H](c1cccc([N+](=O)[O-])c1)N(C)Cc1ncn[nH]1 |
| InChI | InChI=1S/C12H15N5O2/c1-9(16(2)7-12-13-8-14-15-12)10-4-3-5-11(6-10)17(18)19/h3-6,8-9H,7H2,1-2H3,(H,13,14,15)/t9-/m0/s1 |
| InChIKey | JAXVIMIHFKDBDB-VIFPVBQESA-N |
| XLogP | 1.91 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|