C10H16ClN — CID 141121906
(1S)-N,N-dimethyl-1-phenylethanamine;hydrochloride (PubChem CID 141121906) has the molecular formula C10H16ClN and a molecular weight of 185.70 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-phenylethanamine;hydrochloride.
| Compound Name | (1S)-N,N-dimethyl-1-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 141121906 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (1S)-N,N-dimethyl-1-phenylethanamine;hydrochloride |
| SMILES | C[C@@H](c1ccccc1)N(C)C.Cl |
| InChI | InChI=1S/C10H15N.ClH/c1-9(11(2)3)10-7-5-4-6-8-10;/h4-9H,1-3H3;1H/t9-;/m0./s1 |
| InChIKey | BVWBACQXDIZOBP-FVGYRXGTSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |