C11H18ClNO — CID 163285620
(2R)-2-(dimethylamino)-1-phenylpropan-1-ol;hydrochloride (PubChem CID 163285620) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is (2R)-2-(dimethylamino)-1-phenylpropan-1-ol;hydrochloride.
| Compound Name | (2R)-2-(dimethylamino)-1-phenylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 163285620 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (2R)-2-(dimethylamino)-1-phenylpropan-1-ol;hydrochloride |
| SMILES | C[C@H](C(O)c1ccccc1)N(C)C.Cl |
| InChI | InChI=1S/C11H17NO.ClH/c1-9(12(2)3)11(13)10-7-5-4-6-8-10;/h4-9,11,13H,1-3H3;1H/t9-,11?;/m1./s1 |
| InChIKey | NTCYWJCEOILKNG-INDIWFAOSA-N |
| XLogP | 2.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |