C28H28O4 — CID 159073808
1,2-diphenylethane-1,2-diol (PubChem CID 159073808) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-diol.
| Compound Name | 1,2-diphenylethane-1,2-diol |
|---|---|
| PubChem CID | 159073808 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1,2-diphenylethane-1,2-diol |
| SMILES | OC(c1ccccc1)C(O)c1ccccc1.OC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/2C14H14O2/c2*15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h2*1-10,13-16H |
| InChIKey | JZZMYFXHAZMZOO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |