C18H22O6 — CID 134931219
(1R,2S,3S,4S,5S,6R)-1,6-diphenylhexane-1,2,3,4,5,6-hexol (PubChem CID 134931219) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (1R,2S,3S,4S,5S,6R)-1,6-diphenylhexane-1,2,3,4,5,6-hexol.
| Compound Name | (1R,2S,3S,4S,5S,6R)-1,6-diphenylhexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 134931219 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1R,2S,3S,4S,5S,6R)-1,6-diphenylhexane-1,2,3,4,5,6-hexol |
| SMILES | O[C@H]([C@@H](O)[C@@H](O)[C@H](O)c1ccccc1)[C@@H](O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H22O6/c19-13(11-7-3-1-4-8-11)15(21)17(23)18(24)16(22)14(20)12-9-5-2-6-10-12/h1-10,13-24H/t13-,14-,15+,16+,17+,18+/m1/s1 |
| InChIKey | ZGOQXEPZIRQVMP-ZMSHIADSSA-N |
| XLogP | -0.10 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |