C14H15NO — CID 11745978
(1R,2S)-2-(15N)azanyl-1,2-diphenylethanol (PubChem CID 11745978) has the molecular formula C14H15NO and a molecular weight of 214.27 g/mol. Its IUPAC name is (1R,2S)-2-(15N)azanyl-1,2-diphenylethanol.
| Compound Name | (1R,2S)-2-(15N)azanyl-1,2-diphenylethanol |
|---|---|
| PubChem CID | 11745978 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (1R,2S)-2-(15N)azanyl-1,2-diphenylethanol |
| SMILES | [15NH2][C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14,16H,15H2/t13-,14+/m0/s1/i15+1 |
| InChIKey | GEJJWYZZKKKSEV-JGEUXBCSSA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |