C14H16O3 — CID 174439943
benzene;2-phenylethane-1,1,2-triol (PubChem CID 174439943) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is benzene;2-phenylethane-1,1,2-triol.
| Compound Name | benzene;2-phenylethane-1,1,2-triol |
|---|---|
| PubChem CID | 174439943 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | benzene;2-phenylethane-1,1,2-triol |
| SMILES | OC(O)C(O)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C8H10O3.C6H6/c9-7(8(10)11)6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5,7-11H;1-6H |
| InChIKey | COCPMASQLSEWPS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|