C8H8F2O — CID 12955760
(1R)-2,2-difluoro-1-phenylethanol (PubChem CID 12955760) has the molecular formula C8H8F2O and a molecular weight of 158.15 g/mol. Its IUPAC name is (1R)-2,2-difluoro-1-phenylethanol.
| Compound Name | (1R)-2,2-difluoro-1-phenylethanol |
|---|---|
| PubChem CID | 12955760 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (1R)-2,2-difluoro-1-phenylethanol |
| SMILES | O[C@H](c1ccccc1)C(F)F |
| InChI | InChI=1S/C8H8F2O/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,7-8,11H/t7-/m1/s1 |
| InChIKey | XOYZGEQHDLLDHZ-SSDOTTSWSA-N |
| XLogP | 1.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |