C14H16ClNO — CID 145453159
(1R,2R)-2-amino-1,2-diphenylethanol;hydrochloride (PubChem CID 145453159) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is (1R,2R)-2-amino-1,2-diphenylethanol;hydrochloride.
| Compound Name | (1R,2R)-2-amino-1,2-diphenylethanol;hydrochloride |
|---|---|
| PubChem CID | 145453159 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (1R,2R)-2-amino-1,2-diphenylethanol;hydrochloride |
| SMILES | Cl.N[C@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO.ClH/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;/h1-10,13-14,16H,15H2;1H/t13-,14-;/m1./s1 |
| InChIKey | DWMRKFHDHZDONL-DTPOWOMPSA-N |
| XLogP | 2.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |