C10H14O4 — CID 66722513
(2R,3R)-1-phenylbutane-1,2,3,4-tetrol (PubChem CID 66722513) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2R,3R)-1-phenylbutane-1,2,3,4-tetrol.
| Compound Name | (2R,3R)-1-phenylbutane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 66722513 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2R,3R)-1-phenylbutane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)C(O)c1ccccc1 |
| InChI | InChI=1S/C10H14O4/c11-6-8(12)10(14)9(13)7-4-2-1-3-5-7/h1-5,8-14H,6H2/t8-,9?,10+/m1/s1 |
| InChIKey | WPOFFPSLZXBIEQ-FIBVVXLUSA-N |
| XLogP | -0.57 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |