C9H11BrO2 — CID 21270529
2-bromo-1-phenylpropane-1,3-diol (PubChem CID 21270529) has the molecular formula C9H11BrO2 and a molecular weight of 231.09 g/mol. Its IUPAC name is 2-bromo-1-phenylpropane-1,3-diol.
| Compound Name | 2-bromo-1-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 21270529 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 2-bromo-1-phenylpropane-1,3-diol |
| SMILES | OCC(Br)C(O)c1ccccc1 |
| InChI | InChI=1S/C9H11BrO2/c10-8(6-11)9(12)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6H2 |
| InChIKey | PRAAUCGHEXPEEI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|