C9H10Br2O — CID 11300855
(2R,3S)-2,3-dibromo-3-phenylpropan-1-ol (PubChem CID 11300855) has the molecular formula C9H10Br2O and a molecular weight of 293.99 g/mol. Its IUPAC name is (2R,3S)-2,3-dibromo-3-phenylpropan-1-ol.
| Compound Name | (2R,3S)-2,3-dibromo-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11300855 |
| Molecular Formula | C9H10Br2O |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.91 |
| IUPAC Name | (2R,3S)-2,3-dibromo-3-phenylpropan-1-ol |
| SMILES | OC[C@@H](Br)[C@@H](Br)c1ccccc1 |
| InChI | InChI=1S/C9H10Br2O/c10-8(6-12)9(11)7-4-2-1-3-5-7/h1-5,8-9,12H,6H2/t8-,9+/m1/s1 |
| InChIKey | QBFQIVMHGSMOJV-BDAKNGLRSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|