C9H9Br2FO — CID 139985388
2,3-dibromo-3-(4-fluorophenyl)propan-1-ol (PubChem CID 139985388) has the molecular formula C9H9Br2FO and a molecular weight of 311.98 g/mol. Its IUPAC name is 2,3-dibromo-3-(4-fluorophenyl)propan-1-ol.
| Compound Name | 2,3-dibromo-3-(4-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 139985388 |
| Molecular Formula | C9H9Br2FO |
| Molecular Weight | 311.98 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 2,3-dibromo-3-(4-fluorophenyl)propan-1-ol |
| SMILES | OCC(Br)C(Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9Br2FO/c10-8(5-13)9(11)6-1-3-7(12)4-2-6/h1-4,8-9,13H,5H2 |
| InChIKey | DQAFCBRNFILMMH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.98 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|