C9H7Br2FO2 — CID 122714820
2,3-dibromo-3-(4-fluorophenyl)propanoic acid (PubChem CID 122714820) has the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. Its IUPAC name is 2,3-dibromo-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2,3-dibromo-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 122714820 |
| Molecular Formula | C9H7Br2FO2 |
| Molecular Weight | 325.96 g/mol |
| Exact Mass | 323.88 |
| IUPAC Name | 2,3-dibromo-3-(4-fluorophenyl)propanoic acid |
| SMILES | O=C(O)C(Br)C(Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H7Br2FO2/c10-7(8(11)9(13)14)5-1-3-6(12)4-2-5/h1-4,7-8H,(H,13,14) |
| InChIKey | OVVPLFMUTUDGCL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.96 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|