C15H12BrFO2 — CID 46868148
(2S,3S)-2-bromo-3-(4-fluorophenyl)-3-hydroxy-1-phenylpropan-1-one (PubChem CID 46868148) has the molecular formula C15H12BrFO2 and a molecular weight of 323.16 g/mol. Its IUPAC name is (2S,3S)-2-bromo-3-(4-fluorophenyl)-3-hydroxy-1-phenylpropan-1-one.
| Compound Name | (2S,3S)-2-bromo-3-(4-fluorophenyl)-3-hydroxy-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 46868148 |
| Molecular Formula | C15H12BrFO2 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | (2S,3S)-2-bromo-3-(4-fluorophenyl)-3-hydroxy-1-phenylpropan-1-one |
| SMILES | O=C(c1ccccc1)[C@@H](Br)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12BrFO2/c16-13(14(18)10-4-2-1-3-5-10)15(19)11-6-8-12(17)9-7-11/h1-9,13,15,19H/t13-,15+/m1/s1 |
| InChIKey | UBPZGPWHDCKPSS-HIFRSBDPSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|